Zu "467459-31-0" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
idalopirdine
Artikelnummer: TGM-T7103-100mg
Description: Idalopirdine (Lu AE58054), a selective 5-HT6 receptor antagonist( Ki : 0.83 nM),as a treatment for Alzheimer's disease. Target: 5-HT Receptor. Smiles: C(CNCC1=CC(OCC(C(F)F)(F)F)=CC=C1)C=2C=3C(NC2)=CC(F)=CC3. References: Galimberti D , Scarpini E . Idalopirdine as a treatment for Alzheimer's disease[J]....
| Schlagworte: | Lu AE58054 |
| Anwendung: | Targets 5-hydroxytryptamine receptor 6 (HTR6) |
| CAS | 467459-31-0 |
| MW: | 398.37 D |
ab 81,00 €
Lu AE58054
Artikelnummer: Cay27335-10
LU AE58054 is an antagonist of the serotonin (5-HT) receptor subtype 5-HT6 (Ki = 0.83 nM). It is selective for 5-HT6 over other 5-HT receptor subtypes (Kis = 250 to >10,000 nM) and 70 other targets but does bind to alpha1A- and alpha1B-adrenergic receptors (alpha1B-ARs, Kis = 21 and 22 nM, respectively). LU AE58054...
| Schlagworte: | 6-fluoro-N-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]-1H-indole-3-ethanamine |
| Anwendung: | Serotonin receptor 5-HT6 antagonist |
| CAS | 467459-31-0 |
| MW: | 398.4 D |
81,00 €
Lu AE58054
Artikelnummer: Cay27335-100
LU AE58054 is an antagonist of the serotonin (5-HT) receptor subtype 5-HT6 (Ki = 0.83 nM). It is selective for 5-HT6 over other 5-HT receptor subtypes (Kis = 250 to >10,000 nM) and 70 other targets but does bind to alpha1A- and alpha1B-adrenergic receptors (alpha1B-ARs, Kis = 21 and 22 nM, respectively). LU AE58054...
| Schlagworte: | 6-fluoro-N-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]-1H-indole-3-ethanamine |
| Anwendung: | Serotonin receptor 5-HT6 antagonist |
| CAS | 467459-31-0 |
| MW: | 398.4 D |
ab 192,00 €
