Zu "443892-56-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
HMBPP triammonium
Artikelnummer: TGM-T32087-10mg
Description: HMBPP triammonium is a stimulator of gamma delta T cells. Target: Others. Smiles: N.C\C(CO)=C/COP(O)(=O)OP(O)(O)=O. References: Poupot, M., and Fournié, J.J. Non-peptide antigens activating human Vg9/Vd2 T lymphocytes. Immunology Letters 95, 129-138 (2004).
| Schlagworte: | HMB-PP triammonium, HMB-PP triammonium salt, HMBPP triammonium salt |
| Anwendung: | Microbial deoxyxylulose-phosphate pathway metabolite, TCR ligand |
| CAS | 443892-56-6 |
| MW: | 279.122 D |
ab 337,00 €
HDMAPP (ammonium salt)
Artikelnummer: Cay13580-1
HDMAPP is a metabolite of the microbial dioxyxylulose-phosphate pathway, which is analogous to the isopentenyl pyrophosphate pathway in mammals. It is a protease-resistant and phosphatase-sensitive pyrophosphate produced by bacteria and plants. HDMAPP is a non-peptide ligand, also called a phosphoantigen, that binds...
| Schlagworte: | HMBPP, mono[(2E)-hydroxy-3-methyl-2-butenyl] ester diphosphoric acid, triammonium salt |
| Anwendung: | Microbial deoxyxylulose-phosphate pathway metabolite, TCR ligand |
| CAS | 443892-56-6 |
| MW: | 313.2 D |
ab 102,00 €
