Zu "442632-72-6" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
CK-636
Artikelnummer: TGM-T1820-100mg
Description: CK-636 (CK-0944636), an Arp2/3 complex inhibitor, can inhibit actin polymerization induced by the human (IC50: 4 µM), fission yeast (IC50: 24 µM) and bovine (IC50: 32 µM) Arp2/3 complex, respectively. Target: Microtubule Associated. Smiles: Cc1[nH]c2ccccc2c1CCNC(=O)c1cccs1. References: Nolen BJ, et al....
| Schlagworte: | CK-0944636, CK 636 |
| Anwendung: | Arp2/3 complex inhibitor |
| CAS | 442632-72-6 |
| MW: | 284.38 D |
ab 31,00 €
CK-636
Artikelnummer: Cay16243-10
CK-636 is an inhibitor of Arp2/3 complex action that binds the complex and inhibits actin polymerization in vitro, using human, bovine and fission yeast proteins (IC50s = 4, 32, and 24 µM, respectively). It is cell permeable, as it prevents actin polymerization and the formation of actin filament comet tails by...
| Schlagworte: | N-[2-(2-methyl-1H-indol-3-yl)ethyl]-2-thiophenecarboxamide |
| Anwendung: | Arp2/3 complex inhibitor |
| CAS | 442632-72-6 |
| MW: | 284.4 D |
ab 85,00 €
CK-636
Artikelnummer: LKT-C4000.25
Arp2/3 inhibitor.
| Schlagworte: | CK636, CK-0944636 |
| Anwendung: | Arp2/3 inhibitor |
| CAS | 442632-72-6 |
| MW: | 284.38 D |
ab 128,00 €
