Zu "432020-20-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
SMI481
Artikelnummer: TGM-T26195-100mg
Description: SMI481 (NPPM6748481) is the first small-molecule Sec14-like phosphatidylinositol transfer proteins (PITPs) inhibitor. Target: Others. Smiles: [O-][N+](=O)c1cc(ccc1Cl)C(=O)N1CCN(CC1)c1ccccc1F. References: Nile AH, Tripathi A, Yuan P, Mousley CJ, Suresh S, Wallace IM, Shah SD, Pohlhaus DT, Temple B,...
| Schlagworte: | NPPM 6748481, NPPM6748481, NPPM 6748-481, NPPM-6748-481, SMI-481 SMI 481 |
| CAS | 432020-20-7 |
| MW: | 363.77 D |
ab 39,00 €
SMI-481
Artikelnummer: Cay17637-1
Phosphatidylinositol (PtdIns) transfer proteins (PITPs) mediate the exchange of PtdIns and phosphatidylcholine between membranes, a step required for a wide array of cellular processes including cell division. SMI-481 is an inhibitor of the yeast PITP Sec14, blocking both Sec14-mediated transfer of [3H]-PtdIns in...
| Schlagworte: | (4-chloro-3-nitrophenyl)[4-(2-fluorophenyl)-1-piperazinyl]-methanone |
| Anwendung: | Yeast PITP Sec14 inhibitor |
| CAS | 432020-20-7 |
| MW: | 363.8 D |
ab 43,00 €
