Zu "43153-07-7" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
NEU
2-(4-Formylphenyl)propionic Acid
Artikelnummer: Cay45718-100
2-(4-Formylphenyl)propionic acid is a degradation product of ibuprofen (Cay70280).. SMILES: CC(C1=CC=C(C=O)C=C1)C(O)=O. InChi Code: InChI=1S/C10H10O3/c1-7(10(12)13)9-4-2-8(6-11)3-5-9/h2-7H,1H3,(H,12,13). InChi Key: IAXYHYOWEQQFMC-UHFFFAOYSA-N
| Schlagworte: | Ibuprofen Impurity K, 4-formyl-alpha-methyl-benzeneacetic acid |
| Anwendung: | Ibuprofen degradation product |
| CAS | 43153-07-7 |
| MW: | 178.19 D |
ab 82,00 €
Ibuprofen Impurity K
Artikelnummer: CDX-I0303-M100
The metabolite (2RS)-2-(4-Formylphenyl)propionic acid (Ibuprofen Impurity K) is a degradation product arising from oxidative and thermal treatments of Ibuprofen which is a non-steroidal anti-inflammatory drug (NSAID) used to relieve pain from various conditions such as headache, dental pain or menstrual cramps....
| Schlagworte: | (2RS)-2-(4-Formylphenyl)propionic acid, FPP |
| Anwendung: | Building block, degradation product |
| CAS | 43153-07-7 |
| MW: | 178.18 D |
ab 218,00 €
Ibuprofen Impurity K
Artikelnummer: TGM-T40537-100mg
Description: Ibuprofen Impurity K is a compound that serves as an impurity in Ibuprofen. Ibuprofen itself is an anti-inflammatory inhibitor specifically designed to target COX-1 and COX-2. It exhibits inhibitory activity with IC50 values of 13 µM and 370 µM for COX-1 and COX-2, respectively. Target: Others. Smiles:...
| CAS | 43153-07-7 |
| MW: | 178.18 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
