Zu "419547-11-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Grassofermata
Artikelnummer: Cay26202-5
Grassofermata is an inhibitor of fatty acid transport. It inhibits C1-BODIPY-C12 uptake in HepG2, Caco-2, C2C12, and INS-1E cells (IC50s = 8.1-10.6 µM). Grassofermata prevents palmitate-mediated lipid accumulation and cell death in HepG2 cells and primary hepatocytes. In vivo, grassofermata (300 mg/kg) decreases...
| Schlagworte: | NAV2729, 3-(4-chlorophenyl)-5-(4-nitrophenyl)-2-(phenylmethyl)-pyrazolo[1,5-a]pyrimidin-7(4H)-one |
| Anwendung: | ARF6 inhibitor |
| CAS | 419547-11-8 |
| MW: | 456.9 D |
ab 49,00 €
NAV-2729
Artikelnummer: TGM-T5142-100mg
Description: NAV-2729 inhibits six ArfGEFs (human ARNO, EFA6, BIG1, and BRAG2 and Legionella and Rickettsia RalF), the strongest effects being against BRAG2, Arf1 and Arf6. Target: Others, GTPase. Smiles: [O-][N+](=O)c1ccc(cc1)-c1cc(=O)n2nc(Cc3ccccc3)c(-c3ccc(Cl)cc3)c2[nH]1. References: Benabdi S, et al....
| Anwendung: | ARF6 inhibitor |
| CAS | 419547-11-8 |
| MW: | 456.88 D |
ab 37,00 €
