Zu "41468-25-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Pyridoxal 5'-phosphate monohydrate
Artikelnummer: CDX-P0461-G005
The enzyme cofactor Pyridoxal-5'-phosphate monohydrate is a vitamin B6 metabolite that can modify lysyl and valyl residues in proteins. It acts as a coenzyme in transamination reactions by forming a Schiff-base linkage with lysine groups on aminotransferase. Also serves as a coenzyme in some decarboxylation and...
| Schlagworte: | P5P, PLP, Codecarboxylase, 3-Hydroxy-2-methyl-5-([phosphonooxy]methyl)-4-pyridinecarboxaldehyde, Pyridoxal 5-phosphate,... |
| Anwendung: | Vitamin B6 metabolite |
| CAS | 41468-25-1 |
| MW: | 265.16 D |
ab 77,00 €
Pyridoxal 5'-phosphate monohydrate
Artikelnummer: TGM-T8083-500mg
Description: Quinaldic acid is an endogenous metabolite.Quinaldic acid is a metal chelator. Target: Others. Smiles: Cc1ncc(COP(O)(O)=O)c(C=O)c1O. References: Carlos Alberto Calderónm2spina, Mauricio Orlando Navacmesa. B Vitamins in the nervous system: Current knowledge of the biochemical modes of action and...
| Schlagworte: | Pyridoxal phosphate monohydrate, Pyridoxal 5-phosphate monohydrate |
| Anwendung: | Supplement (vitamin B6) |
| CAS | 41468-25-1 |
| MW: | 265.16 D |
ab 29,00 €
