Zu "40951-21-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
alpha-Hydroxyglutaric Acid (sodium salt)
Artikelnummer: Cay16374-10
alpha-Hydroxyglutaric acid (2-HG) is an alpha-hydroxy acid. It is metabolized to 2-oxoglutarate by D- and L-2-hydroxyglutarate dehydrogenases, and mutations in these enzymes lead to 2-hydroxyglutaric aciduria, a neurometabolic disorder characterized by increased levels of L-2-hydroxyglutaric acid (Cay-21123). 2-HG...
| Schlagworte: | 2-HG, 2-Hydroxyglutaric Acid, 2-hydroxy-pentanedioic acid, disodium salt |
| Anwendung: | alpha-ketoglutarate-dependent dioxygenase inhibitor |
| CAS | 40951-21-1 |
| MW: | 192.1 D |
ab 73,00 €
DL-alpha-Hydroxyglutaric acid disodium salt
Artikelnummer: TGM-T21665-100mg
Description: DL-alpha-Hydroxyglutaric acid disodium salt is an alpha-ketoglutarate (alpha-KG) antagonist that inhibits a variety of alpha-KG-dependent dioxygenases. Target: Endogenous Metabolite, Others, Histone Demethylase. Smiles: [Na+].[Na+].OC(CCC([O-])=O)C([O-])=O
| Schlagworte: | disodium 2-hydroxypentanedioate |
| CAS | 40951-21-1 |
| MW: | 192.08 D |
ab 29,00 €
