Zu "404950-80-7" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
LBH-589
Artikelnummer: LKT-L0528.25
HDAC1/2/3/11 inhibitor.
| Schlagworte: | LBH589, Panobinostat |
| Anwendung: | Histone deacetylases (HDACs) inhibitor |
| CAS | 404950-80-7 |
| MW: | 349.43 D |
ab 103,00 €
Panobinostat
Artikelnummer: Cay13280-5
Panobinostat is a pan-inhibitor of histone deacetylases (HDACs, Kis = 0.6-31 nM for HDAC1-11). It inhibits growth in a panel of 37 human or mouse lung cancer cell lines, including small cell lung cancer (SCLC), non-small cell lung cancer (NSCLC), and mesothelioma cells (IC50s = 4-175, 5-310, and 5-470 nM,...
| Schlagworte: | LBH-589, (2E)-N-hydroxy-3-[4-[[[2-(2-methyl-1H-indol-3-yl)ethyl]amino]methyl]phenyl]-2-propenamide |
| Anwendung: | HDAC inhibitor |
| CAS | 404950-80-7 |
| MW: | 349.4 D |
ab 45,00 €
Panobinostat
Artikelnummer: TGM-T2383-100mg
Description: Panobinostat (NVP-LBH589) is a broad-spectrum HDAC inhibitor (IC50=5 nM) with oral activity and non-selectivity. Panobinostat has antitumor activity and induces apoptosis and autophagy. Target: HIV Protease, Apoptosis, HDAC, Autophagy. Smiles: Cc1[nH]c2ccccc2c1CCNCc1ccc(\C=C\C(=O)NO)cc1. References:...
| Schlagworte: | NVP-LBH589, LBH589 |
| CAS | 404950-80-7 |
| MW: | 349.43 D |
ab 31,00 €
