Zu "40254-90-8" wurden 2 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
Cdk1/5 Inhibitor
Cdk1/5 Inhibitor

Artikelnummer: Cay18740-1

Cyclin-dependent kinases (Cdks) are key regulators of cell cycle progression and are therefore promising targets for cancer therapy. Cdk1/5 Inhibitor is a pyrazolo [3,4-b] quioxaline that inhibits Cdk1/cyclin B and Cdk5/p25 (IC50s = 600 and 400 nM, respectively). It less potently inhibits GSK3beta (IC50 = 1 µM) and...
Schlagworte: Cyclin-dependent kinase 1/5 Inhibitor, NSC 693868, 1H-pyrazolo[3,4-b]quinoxalin-3-amine
Anwendung: Cdk1/cyclin B inhibitor, Cdk5/p25 inhibitor
CAS 40254-90-8
MW: 185.2 D
ab 76,00 €
Bewerten
NSC 693868
NSC 693868

Artikelnummer: TGM-T23093-100mg

Description: CDKs and GSK-3 inhibitor. Target: Others. Smiles: NC=1C=2C(NC=3C(N2)=CC=CC3)=NN1
CAS 40254-90-8
MW: 185.19 D
ab 1.440,00 €
Bewerten