Zu "396129-53-6" wurden 4 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
LY364947
Artikelnummer: Cay13341-5
Transforming growth factor-beta (TGF-beta) signals through a cell surface heteromeric complex involving type I (TGF-beta RI) and type II (TGF-beta RII) receptors. Downstream signal transduction is mediated by the TGF-beta RI kinase domain through the phosphorylation of Smad proteins. LY364947 is a selective...
| Schlagworte: | HTS 466284, TGF-beta RI Kinase Inhibitor, 4-[3-(2-pyridinyl)-1H-pyrazol-4-yl]-quinoline |
| Anwendung: | TGFbetaRI inhibitor |
| CAS | 396129-53-6 |
| MW: | 272.3 D |
ab 100,00 €
LY-364947
Artikelnummer: LKT-L9800.1
ALK5 (activin-like) inhibitor.
| Schlagworte: | LY364947 |
| Anwendung: | ALK5 (activin-like) inhibitor |
| CAS | 396129-53-6 |
| MW: | 272.31 D |
ab 104,00 €
LY-364947
Artikelnummer: TGM-T2048-100mg
Description: LY-364947 (HTS466284) is a potent ATP-competitive inhibitor of TGFbetaR-I. Target: MLK, Casein Kinase, TGF-beta/Smad, RIP kinase. Smiles: N1C=C(C(=N1)C1=NC=CC=C1)C1=CC=NC2=CC=CC=C12. References: Li HY, et al. J Med Chem, 2006, 49(6), 2138-2142.
| Schlagworte: | HTS466284, LY 364947 |
| Anwendung: | TGFbetaRI inhibitor |
| CAS | 396129-53-6 |
| MW: | 272.3 D |
ab 56,00 €
