Zu "394694-98-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
MitoBloCK-10
Artikelnummer: TGM-T8741-100mg
Description: MitoBloCK-10 (3-fluoro-N'-[(E)-(5-nitrothiophen-2-yl)m) inhibits Tim44 binding to the precursor and to Hsp70.MitoBloCK-10 is the first small molecule modulator to attenuate protein-associated motor (PAM) complex activity. Target: Others. Smiles: [O-][N+](=O)c1ccc(\C=N\NC(=O)c2cccc(F)c2)s1. References:...
| Schlagworte: | 3-fluoro-N'-[(E)-(5-nitrothiophen-2-yl)m |
| CAS | 394694-98-5 |
| MW: | 293.27 D |
ab 60,00 €
MitoBloCK-10
Artikelnummer: Cay42054-1
A mitochondrial protein import inhibitor, inhibits the import of cytochrome c1 into the mitochondrial intermembrane space in yeast cells at 100 µM, inhibits migration and invasion of, and induces apoptosis and cell cycle arrest at the G1 phase in, primary human bladder cancer cells at 25 µM, induces mitochondrial...
| Schlagworte: | MB-10, 3-fluoro-benzoic acid 2-[(5-nitro-2-thienyl)methylene]hydrazide |
| Anwendung: | Mitochondrial protein import inhibitor |
| CAS | 394694-98-5 |
| MW: | 293.27 D |
ab 40,00 €
