Zu "39069-52-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
GS-39783
Artikelnummer: Cay29482-10
GS-39783 is a positive allosteric modulator of GABAB receptors that potentiates GABA-stimulated [35S]GTPgammaS binding to recombinant human GABAB receptors and rat cortical membranes (EC50s = 2.1 and 3.1 µM, respectively). It amplifies GABAB receptor-mediated transient calcium signaling in HEK293 cells expressing...
| Schlagworte: | N4,N6-dicyclopentyl-2-(methylthio)-5-nitro-4,6-pyrimidinediamine |
| Anwendung: | GABA-B receptor positive allosteric modulator |
| CAS | 39069-52-8 |
| MW: | 337.4 D |
ab 94,00 €
GS 39783
Artikelnummer: TGM-T22813-100mg
Description: GS 39783 is a positive allosteric modulator (PAM) of GABABR, which reduces the motivational properties of alcohol and the conditioned reinforcement and conditional reward of psychostimulants. Target: GABA Receptor. Smiles: N(C=1C(N(=O)=O)=C(NC2CCCC2)N=C(SC)N1)C3CCCC3. References: Emmanuel Sturchler, et...
| CAS | 39069-52-8 |
| MW: | 337.44 D |
ab 40,00 €
