Zu "39036-04-9" wurden 2 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
1,2-Diheptanoyl-sn-glycero-3-PC
1,2-Diheptanoyl-sn-glycero-3-PC

Artikelnummer: Cay25586-100

1,2-Diheptanoyl-sn-glycero-3-PC (DHPC-C7) is a synthetic phosphatidylcholine containing the short-chain (7:0) heptanoic acid at the sn-1 and sn-2 positions. It is commonly used in the formation of lipid bilayers and mixed micelles that has a critical micelle concentration (CMC) of 1.6 mM. Short-chain phospholipids,...
Schlagworte: DHPC-C7, di-C7-PC, (7R)-4-hydroxy-N,N,N-trimethyl-10-oxo-7-[(1-oxoheptyl)oxy]-3,5,9-trioxa-4-phosphahexadecan-1-aminium,...
Anwendung: Synthetic phosphatidylcholine, lipid bilayer formation
CAS 39036-04-9
MW: 481.6 D
ab 131,00 €
Bewerten
Diheptanoyllecithin
Diheptanoyllecithin

Artikelnummer: TGM-T31460-100mg

Description: Diheptanoyllecithin is a non-hydrolyzable analog. Target: Others. Smiles: CCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCCCCC. References: Canziani G, Seki C, Vidal JC. Accessibility of the active site of crotoxin B in the crotoxin complex. Toxicon. 1982,20(5):809-22. PubMed PMID: 7179290.
Schlagworte: L-alpha-Diheptanoyllecithin
CAS 39036-04-9
MW: 481.56 D
ab 301,00 €
Bewerten