Zu "383907-47-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
DA-3003-2
Artikelnummer: Cay17282-1
Cdc25 dual-specific protein tyrosine phosphatases are important for cell cycle progression and often overexpressed in cancers. Through the removal of inhibitory phosphates, they function to catalyze the activation of cyclin-Cdk complexes. DA-3003-2 is a Cdc25 phosphatase inhibitor (IC50 = 0.82 µM for human...
| Schlagworte: | NSC 663285, 7-chloro-6-[[2-(4-morpholinyl)ethyl]amino]-5,8-quinolinedione |
| Anwendung: | Cdc25 phosphatase inhibitor |
| CAS | 383907-47-9 |
| MW: | 321.8 D |
ab 93,00 €
DA 3003-2
Artikelnummer: TGM-T69316-10mg
Description: DA 3003-2, a selectively potent Cdc25 inhibitor, exhibits antiproliferative activity and holds potential for prostate cancer research. It induces cell cycle arrest at the G2/M phase and increases the expression of P-tyr 15 Cdc2. Target: Others. Smiles: ClC1=C(NCCN2CCOCC2)C(=O)c2cccnc2C1=O
| Schlagworte: | NSC663285 |
| Anwendung: | Cdc25 phosphatase inhibitor |
| CAS | 383907-47-9 |
| MW: | 321.76 D |
ab 210,00 €
