Zu "383124-82-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
YE 120
Artikelnummer: Cay29720-1
YE 120 is an agonist of G protein-coupled receptor 35 (GPR35) with an EC50 value of 32 nM in a dynamic mass redistribution (DMR) assay using HT-29 cells. It induces beta-arrestin translocation in Tango GPR35-bla U2OS cells (EC50 = 10.2 µM). YE 120 (10 µM) promotes wound closure in YAMC colonic epithelial and IEC-6...
| Schlagworte: | 2-[3-cyano-5-(3,4-dichlorophenyl)-4,5-dimethyl-2(5H)-furanylidene]-propanedinitrile |
| Anwendung: | GPR35 agonist |
| CAS | 383124-82-1 |
| MW: | 330.2 D |
ab 85,00 €
YE 120
Artikelnummer: TGM-T23542-1mg
Description: YE 120 is a highly potent GPR35 agonist (EC50: 32.5 nM) with potential anti-inflammatory and anti-cancer activities, which can be used to study G protein-coupled receptor-related diseases. Target: GPR. Smiles: N#CC(C#N)=C1OC(C2=CC=C(Cl)C(Cl)=C2)(C(=C1C#N)C)C. References: Deng H, et al. Discovery of...
| Schlagworte: | YE-120, YE120 |
| Anwendung: | GPR35 agonist |
| CAS | 383124-82-1 |
| MW: | 330.17 D |
97,00 €
