Zu "38183-03-8" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
7,8-Dihydroxyflavone
Artikelnummer: Cay16946-100
7,8-Dihydroxyflavone (7,8-DHF) is a flavone that has been found in G. aesculifolia and has diverse biological activities. It binds to tropomyosin-related kinase B (TrkB, Kd = 320 nM) and induces TrkB autophosphorylation in primary mouse hippocampal neurons. In vivo, 7,8-DHF (5 mg/kg) reduces neuronal apoptosis and...
| Schlagworte: | 7,8-DHF, 7,8-dihydroxy-2-phenyl-4H-1-benzopyran-4-one |
| Anwendung: | TrkB agonist |
| CAS | 38183-03-8 |
| MW: | 254.2 D |
ab 49,00 €
7,8-Dihydroxyflavone Hydrate
Artikelnummer: LKT-D3329.100
TrkB agonist.
| Anwendung: | TrkB agonist |
| CAS | 38183-03-8 |
| MW: | 254.24 D |
ab 82,00 €
7,8-Dihydroxyflavone
Artikelnummer: TGM-T2816-100mg
Description: 7,8-Dihydroxyflavone (7,8-DHF) is a naturally-occurring flavone and exist in Tridax procumbens, Godmania aesculifolia, and primula tree leaves. Target: Apoptosis, Trk receptor. Smiles: Oc1ccc2c(oc(cc2=O)-c2ccccc2)c1O. References: Liu C, et al. Transl Neurodegener. 2016, 5:2.
| Schlagworte: | 7,8-DHF |
| Anwendung: | TrkB agonist |
| CAS | 38183-03-8 |
| MW: | 254.24 D |
ab 30,00 €
