Zu "376640-41-4" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
BVT 2733
Artikelnummer: Cay22203-5
BVT 2733 is an inhibitor of 11beta-hydroxysteroid dehydrogenase type 1 (11beta-HSD1, Cay-10007815). In a mouse model of hyperglycemia and hyperinsulinemia, BVT 2733 (100 mg/kg) inhibits 11beta-HSD1 activity in isolated liver and decreases blood glucose and insulin concentrations. It decreases the expression of...
| Schlagworte: | 3-chloro-2-methyl-N-[4-[2-(4-methyl-1-piperazinyl)-2-oxoethyl]-2-thiazolyl]-benzenesulfonamide |
| Anwendung: | 11-beta-HSD1 inhibitor |
| CAS | 376640-41-4 |
| MW: | 429 D |
ab 134,00 €
BVT-2733
Artikelnummer: LKT-B8676.25
11beta-HSD1 inhibitor.
| Schlagworte: | BVT2733 |
| Anwendung: | 11beta-HSD1 inhibitor |
| CAS | 376640-41-4 |
| MW: | 428.96 D |
ab 164,00 €
BVT 2733
Artikelnummer: TGM-T2057-100mg
Description: BVT 2733 is a new, non-steroidal, isoform-specific inhibitor of 11beta-HSD1. Target: Dehydrogenase. Smiles: CN1CCN(CC1)C(=O)Cc1csc(NS(=O)(=O)c2cccc(Cl)c2C)n1
| Anwendung: | 11-beta-HSD1 inhibitor |
| CAS | 376640-41-4 |
| MW: | 428.96 D |
ab 36,00 €
