Zu "374750-30-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
2'-C-beta-Methylguanosine
Artikelnummer: Cay36548-10
2'-C-beta-Methylguanosine is an active nucleoside metabolite of the antiviral prodrug BMS-986094. It inhibits replication in genotype 1b hepatitis C virus (HCV) replicon cells (EC50s = 5.2 and 3.2 µM in ELISA and luciferase assays, respectively). 2'-C-beta-Methylguanosine also inhibits replication of the Zika virus...
| Schlagworte: | 2'-C-methyl-guanosine |
| Anwendung: | BMS-986094 active metabolite |
| CAS | 374750-30-8 |
| MW: | 297.3 D |
ab 80,00 €
2'-C-beta-Methylguanosine
Artikelnummer: TGM-TNU0158-100mg
Description: 2'-C-beta-Methylguanosine (2'-C-Methylguanosine) is a metabolite of the hepatitis C virus nucleotide polymerase inhibitor, BMS-986094, which has antiviral activity and inhibits dengue virus 2. Target: Antiviral. Smiles: C[C@]1(O)[C@H](N2C3=C(N=C2)C(=O)N=C(N)N3)O[C@H](CO)[C@H]1O
| Schlagworte: | 2'-C-Methylguanosine |
| CAS | 374750-30-8 |
| MW: | 297.27 D |
ab 183,00 €
