Zu "3650-09-7" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Carnosic acid
Artikelnummer: TGM-T4957-10mg
Description: Carnosic acid is a lipid absorption inhibitor, endowed with antioxidative, antimicrobial, photoprotective potential, and antiproliferative properties. Target: ROS, Apoptosis, Antibacterial. Smiles: C(O)(=O)[C@@]12C=3C(=CC(C(C)C)=C(O)C3O)CC[C@]1(C(C)(C)CCC2)[H]. References: Albalawi A, et al....
| CAS | 3650-09-7 |
| MW: | 332.43 D |
ab 40,00 €
Carnosic Acid
Artikelnummer: Cay89820-5
Carnosic acid is an active diterpene found in rosemary (R. officinalis) and common sage (S. officinalis). Its antioxidant properties include inhibition of lipid peroxidation and scavenging of peroxyl radicals. Carnosic acid has been shown to be cytotoxic towards various human cancer cell lines, reducing cell...
| Schlagworte: | Rosamox(TM), RoseOx(R), Salvin,... |
| Anwendung: | Antioxidant |
| CAS | 3650-09-7 |
| MW: | 332.4 D |
ab 52,00 €
Carnosic acid
Artikelnummer: LKT-C0265.50
An antioxidant isolated from Rosemary which has shown chemoprotective effects against carcinogens.
| Schlagworte: | Salvin |
| Anwendung: | Chemopreventive agent |
| CAS | 3650-09-7 |
| MW: | 332,43 D |
ab 141,00 €
