Zu "361457-01-4" wurden 2 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
RO3244794
RO3244794

Artikelnummer: Cay25350-1

An IP receptor antagonist (Ki = 20 nM in isolated human platelets), selective for the IP receptor over a panel of 50 receptors at 10 µM but does bind to EP3, EP4, and TP receptors and the adenosine A3 receptor (Kis = 4,169, 1,820, 8,128, and 4,786 nM, respectively), inhibits carbaprostacyclin-induced cAMP...
Schlagworte: 4-fluoro-N-[[[5-(4-fluorophenyl)-2-benzofuranyl]methoxy]carbonyl]-D-phenylalanine
Anwendung: IP receptor antagonist
CAS 361457-01-4
MW: 451.42 D
ab 234,00 €
Bewerten
RO3244794
RO3244794

Artikelnummer: TGM-T69360-10mg

Description: RO3244794 is a selective prostacyclin (IP) receptor antagonist that can be used to study liver injury. Target: Prostaglandin Receptor. Smiles: C(OC(N[C@H](CC1=CC=C(F)C=C1)C(O)=O)=O)C2=CC=3C(O2)=CC=C(C3)C4=CC=C(F)C=C4. References: Bley KR,et al. RO1138452 and RO3244794: characterization of structurally...
CAS 361457-01-4
MW: 451.42 D
ab 163,00 €
Bewerten