Zu "361457-01-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
NEU
RO3244794
Artikelnummer: Cay25350-1
An IP receptor antagonist (Ki = 20 nM in isolated human platelets), selective for the IP receptor over a panel of 50 receptors at 10 µM but does bind to EP3, EP4, and TP receptors and the adenosine A3 receptor (Kis = 4,169, 1,820, 8,128, and 4,786 nM, respectively), inhibits carbaprostacyclin-induced cAMP...
| Schlagworte: | 4-fluoro-N-[[[5-(4-fluorophenyl)-2-benzofuranyl]methoxy]carbonyl]-D-phenylalanine |
| Anwendung: | IP receptor antagonist |
| CAS | 361457-01-4 |
| MW: | 451.42 D |
ab 227,00 €
RO3244794
Artikelnummer: TGM-T69360-10mg
Description: RO3244794 is a selective prostacyclin (IP) receptor antagonist that can be used to study liver injury. Target: Prostaglandin Receptor. Smiles: C(OC(N[C@H](CC1=CC=C(F)C=C1)C(O)=O)=O)C2=CC=3C(O2)=CC=C(C3)C4=CC=C(F)C=C4. References: Bley KR,et al. RO1138452 and RO3244794: characterization of structurally...
| CAS | 361457-01-4 |
| MW: | 451.42 D |
ab 163,00 €
