Zu "355129-15-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
KB2115
Artikelnummer: Cay10011054-5
The thyroid hormones, thyroxine (T4) and triiodothyronine (T3), promote the reduction of plasma cholesterol levels and induce weight loss. However when administered in high doses, thyroid hormones produce undesirable side effects in the heart, bone and muscle. KB2115 is a synthetic thyroid hormone mimetic. At a dose...
| Schlagworte: | Eprotirome, 3-[[3,5-dibromo-4-[4-hydroxy-3-(1-methylethyl)phenoxy]phenyl]amino-3-oxo-propanoic acid |
| Anwendung: | Thyroid hormone mimetic |
| CAS | 355129-15-6 |
| MW: | 487.1 D |
ab 73,00 €
Eprotirome
Artikelnummer: TGM-T5360-100mg
Description: Eprotirome (KB2115), a synthetic thyroid hormone mimetic, is a thyroid hormone receptor agonist. Target: Thyroid hormone receptor(THR). Smiles: CC(C)c1cc(Oc2c(Br)cc(NC(=O)CC(O)=O)cc2Br)ccc1O. References: Berkenstam A, et al. The thyroid hormone mimetic compound KB2115 lowers plasma LDL cholesterol and...
| Schlagworte: | KB2115 |
| CAS | 355129-15-6 |
| MW: | 487.14 D |
ab 48,00 €
