Zu "349554-00-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Enalaprilat-d5
Artikelnummer: Cay45856-100
Enalaprilat-d5 is intended for use as an internal standard for the quantification of enalaprilat (Cay-17603) by GC- or LC-MS. Enalaprilat is an angiotensin-converting enzyme (ACE) inhibitor (IC50 = 5.8 nM) and an active metabolite of the prodrug enalapril (Cay-16041). It reduces the pressor response induced by...
| Schlagworte: | N-[(1S)-1-carboxy-3-(phenyl-d5)propyl]-L-alanyl-L-proline |
| Anwendung: | GC-MS, LC-MS, internal standard, quantification, ACE inhibitor |
| CAS | 349554-00-3 |
| MW: | 353.43 D |
49,00 €
Enalaprilat D5
Artikelnummer: TGM-T11194-1mg
Description: Enalaprilat D5 is the deuterium labeled Enalaprilat, which is an angiotensin-converting enzyme (ACE) inhibitor. Smiles: [2H]c1c([2H])c([2H])c(CC[C@H](N[C@@H](C)C(=O)N2CCC[C@H]2C(O)=O)C(O)=O)c([2H])c1[2H]
| Schlagworte: | MK-422 D5 |
| CAS | 349554-00-3 |
| MW: | 353.43 D |
ab 111,00 €
