Zu "348575-88-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Optovin
Artikelnummer: TGM-T6617-100mg
Description: Optovin is a TRPA1 activator, which is reversibly photoactivated. Target: TRP/TRPV Channel. Smiles: Cc1cc(\C=C2/SC(=S)NC2=O)c(C)n1-c1cccnc1. References: Kokel D, et al. Nat Chem Biol. 2013, 9(4), 257-263.
| Anwendung: | Photoactivatable TRPA1 ligand |
| CAS | 348575-88-2 |
| MW: | 315.41 D |
ab 34,00 €
Optovin
Artikelnummer: Cay14851-10
Optovin is a TRPA1 ligand that can be reversibly photoactivated by violet (405 nm) light. Optovin-treated zebrafish respond to light with vigorous motor excitation (EC50 = 2 µM). Optovin-treated mouse dorsal root ganglia neurons displayed increased intracellular calcium following stimulation with light but only in...
| Schlagworte: | 5-[[2,5-dimethyl-1-(3-pyridinyl)-1H-pyrrol-3-yl]methylene]-2-thioxo-4-thiazolidinone |
| Anwendung: | Photoactivatable TRPA1 ligand |
| CAS | 348575-88-2 |
| MW: | 315.4 D |
ab 111,00 €
