Zu "34562-97-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Pikamilone
Artikelnummer: TGM-T3290-1mL
Description: Pikamilone (Picamilon) is an intelligent medicine. Target: Others. Smiles: OC(=O)CCCNC(=O)C1=CC=CN=C1
| Schlagworte: | Picamilon, Nicotinoyl-GABA |
| CAS | 34562-97-5 |
| MW: | 208.21 D |
ab 49,00 €
Picamilon
Artikelnummer: Cay29397-100
Picamilon is a derivative of gamma-aminobutyric acid (GABA). It increases parietal cortical blood flow in rats and rabbits when administered at doses of 50 mg/kg, i.p. and 10 mg/kg, i.v., respectively. Picamilon (10 mg/kg) increases latency to enter the dark compartment in the passive avoidance conditioned reflex...
| Schlagworte: | Nicotinoyl-GABA, 4-[(3-pyridinylcarbonyl)amino]-butanoic acid |
| Anwendung: | GABA derivative |
| CAS | 34562-97-5 |
| MW: | 208.2 D |
ab 44,00 €
