Zu "343787-29-1" wurden 2 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
CP 673,451
CP 673,451

Artikelnummer: Cay19170-1

CP-673,451 is a selective inhibitor of the platelet-derived growth factor receptor beta (PDGFRbeta) kinase with an IC50 value of 1 nM. It also inhibits the PDGFRalpha kinase (IC50 = 10 nM), but exhibits greater than 450-fold selectivity over other angiogenic receptors such as VEGFR 2, TIE-2, and FGR2. In several in...
Schlagworte: 1-[2-[5-(2-methoxyethoxy)-1H-benzimidazol-1-yl]-8-quinolinyl]-4-piperidinamine
Anwendung: PDGFRbeta inhibitor
CAS 343787-29-1
MW: 417.5 D
ab 67,00 €
Bewerten
CP-673451
CP-673451

Artikelnummer: TGM-T6091-100mg

Description: CP-673451 is a specific inhibitor of PDGFRalpha/beta (IC50: 10/1 nM) with antiangiogenic and antitumor activity and the selectivity is higher 450-fold than other angiogenic receptors. Target: PDGFR, VEGFR, c-Kit. Smiles: COCCOc1ccc2n(cnc2c1)-c1ccc2cccc(N3CCC(N)CC3)c2n1. References: Roberts WG, et al....
Anwendung: PDGFRbeta inhibitor
CAS 343787-29-1
MW: 417.5 D
ab 42,00 €
Bewerten