Zu "33985-68-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
C-DIM5
Artikelnummer: Cay27980-5
C-DIM5 is a para-phenyl-substituted diindolylmethane (C-DIM) and an agonist of the orphan receptor nuclear receptor-related protein 77 (Nur77). It selectively activates Nur77 over peroxisome proliferator receptor gamma (PPARgamma) in reporter assays when used at a concentration of 20 µM. C-DIM5 (10, 15, and 20 µM)...
| Schlagworte: | DIM-C-pPhOCH3, 3,3'-[(4-methoxyphenyl)methylene]bis-1H-indole |
| Anwendung: | Nur77 (NR4A1) agonist |
| CAS | 33985-68-1 |
| MW: | 352.4 D |
ab 51,00 €
DIM-C-pPhOCH3
Artikelnummer: TGM-T4397-100mg
Description: DIM-C-pPhOCH3 (C-DIM5) is a Nerve Growth Factor-Induced Balpha (NGFI-Balpha, Nur77) agonist. Target: Others. Smiles: COc1ccc(cc1)C(c1c[nH]c2ccccc12)c1c[nH]c2ccccc12. References: Bridi MS,etal.Pharmacological Activators of the NR4A Nuclear Receptors Enhance LTP in a CREB/CBP-Dependent...
| Schlagworte: | C-DIM5 |
| Anwendung: | Nur77 (NR4A1) agonist |
| CAS | 33985-68-1 |
| MW: | 352.43 D |
ab 30,00 €
