Zu "339287-36-4" wurden 2 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
Ebio1
Ebio1

Artikelnummer: Cay40604-1

Ebio1 is an activator of the voltage-gated potassium channel Kv7.2. It enhances voltage-induced current amplitude in CHO cells expressing recombinant human Kv7.2 when used at a concentration of 10 µM.Formal Name: N-(1,2-dihydro-5-acenaphthylenyl)-4-fluoro-benzamide. CAS Number: 339287-36-4. Molecular Formula:...
Schlagworte: N-(1,2-dihydro-5-acenaphthylenyl)-4-fluoro-benzamide
Anwendung: Kv7.2 activator
CAS 339287-36-4
MW: 291.3 D
ab 77,00 €
Bewerten
Ebio1
Ebio1

Artikelnummer: TGM-T84693-10mg

Description: Ebio1, a selective activator of the voltage-gated potassium channel KCNQ2, enhances channel conductance by promoting the formation of an expanded gate at a saturation voltage of +50 mV, leading to increased channel activity [1]. Target: Others. Smiles: N(C(=O)C1=CC=C(F)C=C1)C2=C3C4=C(CCC4=CC=C3)C=C2
Anwendung: Kv7.2 activator
CAS 339287-36-4
MW: 291.32 D
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
Bewerten