Zu "339287-36-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Ebio1
Artikelnummer: TGM-T84693-10mg
Description: Ebio1, a selective activator of the voltage-gated potassium channel KCNQ2, enhances channel conductance by promoting the formation of an expanded gate at a saturation voltage of +50 mV, leading to increased channel activity [1]. Target: Others. Smiles: N(C(=O)C1=CC=C(F)C=C1)C2=C3C4=C(CCC4=CC=C3)C=C2
| Anwendung: | Kv7.2 activator |
| CAS | 339287-36-4 |
| MW: | 291.32 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
Ebio1
Artikelnummer: Cay40604-1
Ebio1 is an activator of the voltage-gated potassium channel Kv7.2. It enhances voltage-induced current amplitude in CHO cells expressing recombinant human Kv7.2 when used at a concentration of 10 µM.Formal Name: N-(1,2-dihydro-5-acenaphthylenyl)-4-fluoro-benzamide. CAS Number: 339287-36-4. Molecular Formula:...
| Schlagworte: | N-(1,2-dihydro-5-acenaphthylenyl)-4-fluoro-benzamide |
| Anwendung: | Kv7.2 activator |
| CAS | 339287-36-4 |
| MW: | 291.3 D |
ab 70,00 €
