Zu "339071-18-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
TS-011
Artikelnummer: TGM-T13215-10mg
Description: N-(3-Chloro-4-morpholinophenyl)-N'-hydroxyformimidamide (TS-011) is a selective 20-Hydroxyeicosatetraenoic acid synthesis inhibitor. Target: Others. Smiles: O\N=C\Nc1ccc(N2CCOCC2)c(Cl)c1. References: Marumo T, et al. The inhibitor of 20-HETE synthesis, TS-011, improves cerebral microcirculatory...
| Schlagworte: | TS-011 |
| Anwendung: | 20-HETE synthesis inhibitor |
| CAS | 339071-18-0 |
| MW: | 255.7 D |
ab 106,00 €
TS-011
Artikelnummer: Cay9002862-100
TS-011 is an inhibitor of 20-hydroxyeicosatetraenoic acid (20-HETE) synthesis. It inhibits 20-HETE synthesis in human and rat renal microsomes (IC50s = 8.42 and 9.19 nM, respectively), as well as by the cytochrome P450 (CYP) isoforms CYP4F2, CYP4F3A, CYP4F3B, and CYP4A11 in cell-free assays (IC50s = 30.4, 42.6,...
| Schlagworte: | N-[3-chloro-4-(4-morpholinyl)phenyl]-N'-hydroxy-methanimidamide |
| Anwendung: | 20-HETE synthesis inhibitor |
| CAS | 339071-18-0 |
| MW: | 255.7 D |
ab 153,00 €
