Zu "338967-87-6" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Mdivi-1
Artikelnummer: TGM-T1907-100mg
Description: Mdivi-1 (Mitochondrial division inhibitor 1) is a mitochondrial division inhibitor that inhibits DRP1 and Dynamin I (IC50=1-10 µM). Mdivi-1 inhibits mitochondrial autophagy. Target: Mitophagy, Autophagy, Apoptosis, Dynamin. Smiles: O=C1N(C(=S)NC=2C1=CC=CC2)C3=CC(OC)=C(Cl)C=C3Cl. References: Fang CT,...
| Schlagworte: | Mitochondrial division inhibitor 1 |
| Anwendung: | Mitochondrial division inhibitor, dynamin inhibitor |
| CAS | 338967-87-6 |
| MW: | 353.22 D |
ab 40,00 €
Mdivi 1
Artikelnummer: Cay15559-5
Mdivi 1 is a mitochondrial division inhibitor. It inhibits the GTPase activity of yeast, but not human, dynamin-1 (Dnm1, IC50 = ~1-10 µM for the recombinant yeast enzyme) and human dynamin-related protein 1 (DRP1) in A549 lung cancer cells when used at a concentration of 50 µM. Mdivi 1 (50 µM) inhibits mitochondrial...
| Schlagworte: | Mitochondrial Division Inhibitor 1, 3-(2,4-dichloro-5-methoxyphenyl)-2,3-dihydro-2-thioxo-4(1H)-quinazolinone |
| Anwendung: | Mitochondrial division inhibitor, dynamin inhibitor |
| CAS | 338967-87-6 |
| MW: | 353.2 D |
ab 67,00 €
Mdivi-1
Artikelnummer: LKT-M1335.25
Quinazolinone, mitochondrial division inhibitor.
| Anwendung: | Quinazolinone, mitochondrial division inhibitor |
| CAS | 338967-87-6 |
| MW: | 353.2 D |
ab 105,00 €
