Zu "33889-69-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Silychristin
Artikelnummer: TGM-T3879-100mg
Description: Silychristin (Silicristin) is a plant growth regulator. Silychristin is an anti-hepatotoxic agent. Silychristin is the inhibitor of horseradish peroxidases and lipoxygenase. Target: Lipoxygenase. Smiles: COc1cc(ccc1O)[C@@H]1Oc2c(cc(cc2O)[C@H]2Oc3cc(O)cc(O)c3C(=O)[C@@H]2O)[C@H]1CO. References: Vavríková...
| Schlagworte: | Silicristin |
| Anwendung: | Bioactive flavonolignan |
| CAS | 33889-69-9 |
| MW: | 482.44 D |
ab 43,00 €
Silychristin
Artikelnummer: Cay34658-10
Silychristin is a flavonolignan that has been found in S. marianum and has diverse biological activities. It inhibits monocarboxylate transporter 8 (MCT8, IC50 = ~100 nM) and MCT8-dependent uptake of the thyroid hormone 3,3',5-triiodo-L-thyronine (T3) in MDCK cells and primary mouse astrocytes (IC50s = 170 and 50...
| Schlagworte: | (+)-Silychristin, Silychristin A,... |
| Anwendung: | Bioactive flavonolignan |
| CAS | 33889-69-9 |
| MW: | 482.4 D |
ab 243,00 €
