Zu "336113-53-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Ispinesib
Artikelnummer: Cay18014-5
Ispinesib is a cell-permeable, allosteric inhibitor of Eg5 (Ki app = 2. nM) with >10,000-fold selectivity for Eg5 over a range of other mitotic kinesins. It induces a monopolar spindle phenotype, leading to the activation of a spindle assembly checkpoint, mitotic arrest, and subsequent cell death (GI50s = 22-82 nM...
| Schlagworte: | SB-715992,... |
| Anwendung: | Kinesin spindle protein (KSP/EG5 KIF11) inhibitor |
| CAS | 336113-53-2 |
| MW: | 517.1 D |
ab 44,00 €
Ispinesib
Artikelnummer: TGM-T2103-100mg
Description: Ispinesib (SB-715992), a selective, effectvie and reversible inhibitor of kinesin spindle protein (KSP), is derived from quinazolinone, with antineoplastic properties. Target: Apoptosis, KSP, Kinesin. Smiles: CC(C)[C@@H](N(CCCN)C(=O)c1ccc(C)cc1)c1nc2cc(Cl)ccc2c(=O)n1Cc1ccccc1. References: Lad L, et...
| Schlagworte: | CK0238273, SB-715992 |
| CAS | 336113-53-2 |
| MW: | 517.06 D |
ab 32,00 €
