Zu "332117-28-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
TCS 5861528
Artikelnummer: Cay18380-10
The transient receptor potential ankyrin 1 (TRPA1) ion channel integrates the nociception and transmission of diverse, potentially damaging and noxious stimuli, including cold, electrophilic compounds, divalent cations, and mechanical stimulation. TCS 5861528 is a selective TRPA1 blocker that antagonizes...
| Schlagworte: | 1,2,3,6-tetrahydro-1,3-dimethyl-N-[4-(1-methylpropyl)phenyl]-2,6-dioxo-7H-purine-7-acetamide |
| Anwendung: | TRPA1 blocker |
| CAS | 332117-28-9 |
| MW: | 369.4 D |
ab 126,00 €
Chembridge-5861528
Artikelnummer: TGM-T2711-100mg
Description: Chembridge-5861528 (TCS 5861528) is a TRPA1 channel blocker that inhibits AITC- and 4-HNE-induced calcium influx with IC50 values of 14.3 µM and 18.7 µM, respectively. Target: TRP/TRPV Channel. Smiles: CCC(C)c1ccc(NC(=O)Cn2cnc3n(C)c(=O)n(C)c(=O)c23)cc1
| Schlagworte: | TCS 5861528 |
| Anwendung: | TRPA1 blocker |
| CAS | 332117-28-9 |
| MW: | 369.42 D |
ab 34,00 €
