Zu "331001-62-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
IQ 1
Artikelnummer: TGM-T3635-100mg
Description: IQ 1 has multiple roles, such as maintaining the multifunctionality of mouse ESCs, decreasing Wnt-stimulated phosphorylation, blocking PP2A/Nkd interactions, and so on. Target: Wnt/beta-catenin. Smiles: CC(=O)c1ccc(cc1)\N=N\C(\C(N)=O)=C1\NC(C)(C)Cc2ccccc12. References: Sasaki T, et al. PLoS One. 2013,...
| Schlagworte: | IQ-1, IQ1 |
| Anwendung: | Cell-permeable embryonic stem cell (ESC) pluripotency keeper |
| CAS | 331001-62-8 |
| MW: | 362.42 D |
ab 46,00 €
IQ-1
Artikelnummer: Cay16153-5
IQ-1 is a cell-permeable tetrahydroisoquinolinylidene compound that maintains long-term mouse embryonic stem cell (ESC) pluripotency. When used at 4 µg/ml with Wnt3a, it allows ESCs to form embryoid bodies that continue to express markers of pluripotency, including alpha-fetoprotein and beta-III tubulin. IQ-1 blocks...
| Schlagworte: | 2-[2-(4-acetylphenyl)diazenyl]-2-(3,4-dihydro-3,3-dimethyl-1(2H)-isoquinolinylidene)-acetamide |
| Anwendung: | Cell-permeable embryonic stem cell (ESC) pluripotency keeper |
| CAS | 331001-62-8 |
| MW: | 362.4 D |
ab 145,00 €
