Zu "328023-11-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Rbin-1
Artikelnummer: TGM-T7411-100mg
Description: Rbin-1 (Ribozinoindole-1) is a potent,specific inhibitor of eukaryotic ribosome biogenesis. Target: ATPase, Phosphatase. Smiles: CC(=C)CSc1nnc2c(n1)[nH]c1ccccc21. References: Structural Insights into Mdn1, an Essential AAA Protein Required for Ribosome Biogenesis.
| Schlagworte: | Ribozinoindole-1 |
| Anwendung: | Midasin inhibitor |
| CAS | 328023-11-6 |
| MW: | 256.33 D |
ab 63,00 €
Rbin-1
Artikelnummer: Cay20745-1
Rbin-1 is a triazinoindole inhibitor of midasin (mdn1), an essential protein for eukaryotic ribosome biogenesis. It inhibits the growth of fission yeast strains in vitro (GI50 = 136 nM) and inhibits mdn1 ATPase activity by approximately 40% when used at a concentration of 1 µM. Rbin-1 inhibits pre-rRNA processing...
| Schlagworte: | Ribozinoindole-1, 3-[(2-methyl-2-propen-1-yl)thio]-5H-1,2,4-triazino[5,6-b]indole |
| Anwendung: | Midasin inhibitor |
| CAS | 328023-11-6 |
| MW: | 256.3 D |
ab 128,00 €
