Zu "324523-20-8" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
NPS-2143 hydrochloride
Artikelnummer: TGM-T4967-100mg
Description: NPS-2143 hydrochloride (NPS-2143 HCL) is a selective potent calcium ion-sensing receptor antagonist. Target: CaSR. Smiles: Cl.CC(C)(Cc1ccc2ccccc2c1)NC[C@@H](O)COc1cccc(Cl)c1C#N. References: Marquis, Robert W., Lago, Amparo M., Callahan, James F.,Antagonists of the Calcium Receptor. 2. Amino...
| Schlagworte: | NPS-2143 HCL |
| Anwendung: | CaSR antagonist |
| CAS | 324523-20-8 |
| MW: | 445.38 D |
ab 40,00 €
NPS 2143 (hydrochloride)
Artikelnummer: Cay17903-1
Calcium-sensing receptor (CaSR) is a G protein-coupled receptor that is involved in calcium homeostasis. Activation of CaSR on parathyroid cells decreases the secretion of parathyroid hormone (PTH), which in turn reduces blood calcium concentration. NPS 2143 is a potent and selective antagonist of CaSR (IC50 = 43...
| Schlagworte: | SB-262470A, 2-chloro-6-[(2R)-3-[[1,1-dimethyl-2-(2-naphthalenyl)ethyl]amino]-2-hydroxypropoxy]-benzonitrile,... |
| Anwendung: | CaSR antagonist |
| CAS | 324523-20-8 |
| MW: | 445.4 D |
ab 66,00 €
NPS-2143 Hydrochloride
Artikelnummer: LKT-N6272.1
Ca2+-sensing receptor antagonist.
| Anwendung: | Ca2+-sensing receptor antagonist |
| CAS | 324523-20-8 |
| MW: | 445.38 D |
ab 135,00 €
