Zu "322-79-2" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Triflusal
Artikelnummer: TGM-T0705-100mg
Description: Triflusal (UR1501) is a 2-acetoxy-4-trifluoromethylbenzoic acid and it is an aspirin chemically-related molecule but not a derivative. Target: COX, PDE, PPAR. Smiles: CC(=O)Oc1cc(ccc1C(O)=O)C(F)(F)F. References: Duran X, et al. J Thromb Haemost, 2008, 6(8), 1385-1392.
| Schlagworte: | UR1501 |
| CAS | 322-79-2 |
| MW: | 248.16 D |
ab 40,00 €
Triflusal
Artikelnummer: Cay30274-10
Triflusal is an inhibitor of platelet aggregation (IC50s = 48.3 and 693 µM in isolated human whole blood and platelet-rich plasma, respectively). It inhibits production of thromboxane B2 (TXB2, Cay-19030) and 6 keto prostaglandin F1alpha (6-keto-PGF1alpha, Cay-15210) induced by arachidonic acid (Cay-90010,...
| Schlagworte: | UR 1501, 2-(acetyloxy)-4-(trifluoromethyl)-benzoic acid |
| Anwendung: | Platelet aggregation inhibitor |
| CAS | 322-79-2 |
| MW: | 248.2 D |
ab 85,00 €
Triflusal-13C6
Artikelnummer: ESS0157.100mg
C 49.63% H 2.78% F 22.43% O 25.19%
| Schlagworte: | 2-(Acetyloxy)-4-(trifluoromethyl)benzoic Acid-13C6, alpha,alpha,alpha-Trifluoro-2,4-cresotic Acid Acetate-13C6,... |
| Anwendung: | Labelled analog of Triflusal |
| CAS | 322-79-2 |
| MW: | 254.09 D |
ab 1.558,00 €
