Zu "32142-31-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Vanillic Acid 4-beta-D-glucopyranoside
Artikelnummer: Cay19759-5
Vanillic Acid 4-beta-D-glucopyranoside can be isolated from the fruits of C. annuum as well as the leaves of various additional plants. It belongs to a class of compounds known as hydrolyzable tannins and can be phytotoxic against different species.Formal Name: 4-(beta-D-glucopyranosyloxy)-3-methoxy-benzoic acid....
| Schlagworte: | 4-(beta-D-glucopyranosyloxy)-3-methoxy-benzoic acid |
| CAS | 32142-31-7 |
| MW: | 330.3 D |
ab 89,00 €
Vanillic acid glucoside
Artikelnummer: TGM-TN6506-10mg
Description: Vanillic acid glucoside (Vanillic acid 4-beta-D-glucoside) is a dimeric oxaloside isolated from Hypericum persica. Target: Others. Smiles: O(C1=C(OC)C=C(C(O)=O)C=C1)[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O. References: Sakurai N,et al. Berchemolide, a novel dimeric vanillic acid glucoside from...
| Schlagworte: | Vanillic acid 4-beta-D-glucoside |
| CAS | 32142-31-7 |
| MW: | 330.29 D |
ab 131,00 €
