Zu "315706-13-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
4EGI-1
Artikelnummer: TGM-T2665-10mg
Description: 4EGI-1, a competitive eIF4E/eIF4 g interaction inhibitor, binds to eIF4E(KD=25 µM). Target: Apoptosis, PERK, Autophagy. Smiles: OC(=O)C(\Cc1ccccc1[N+]([O-])=O)=N\Nc1nc(cs1)-c1ccc(Cl)c(Cl)c1. References: Moerke NJ, et al. Cell. 2007, 128(2), 257-267.
| Schlagworte: | 4EGI 1 |
| CAS | 315706-13-9 |
| MW: | 451.28 D |
ab 38,00 €
4EGI-1
Artikelnummer: Cay15362-1
In eukaryotes, a set of initiation factors (eIFs) interact with ribosomal subunits to initiate mRNA translation. A major step in initiation is the assembly of a large multiprotein complex that includes the cap-binding protein eIF4E and the multidomain adaptor protein eIF4G. 4EGI-1 is an inhibitor of the initiation...
| Schlagworte: | eIF4E/eIF4G Interaction Inhibitor, alpha-[2-[4-(3,4-dichlorophenyl)-2-thiazolyl]hydrazinylidene]-2-nitro-benzenepropanoic... |
| Anwendung: | Translation initiation inhibitor |
| CAS | 315706-13-9 |
| MW: | 451.3 D |
ab 61,00 €
