Zu "313649-08-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
UCF 101
Artikelnummer: Cay15550-1
Mammalian Omi/HtrA2 is a serine protease localized in mitochondria with close homology to bacterial HtrA chaperones. It is released from the mitochondria in response to apoptotic stimuli whereupon it induces cell death through both a caspase-dependent manner and a mechanism that involves its protease activity. UCF...
| Schlagworte: | dihydro-5-[[5-(2-nitrophenyl)-2-furanyl]methylene]-1,3-diphenyl-2-thioxo-4,6(1H,5H)-pyrimidinedione |
| Anwendung: | OMI / HTRA2 inhibitor |
| CAS | 313649-08-0 |
| MW: | 495.5 D |
ab 54,00 €
UCF 101
Artikelnummer: TGM-T21919-100mg
Description: UCF 101 is a specific inhibitor of HtrA2 and reduces apoptosis in PC12 cells. Target: Apoptosis. Smiles: [O-][N+](=O)c1ccccc1-c1ccc(C=C2C(=O)N(C(=S)N(C2=O)c2ccccc2)c2ccccc2)o1
| CAS | 313649-08-0 |
| MW: | 495.51 D |
ab 33,00 €
