Zu "313553-47-8" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
INH1
Artikelnummer: Cay29015-5
INH1 is an inhibitor of the interaction between the oncogene high expression in cancer 1 (Hec1) and its regulator, the serine/threonine kinase Nek2. It binds to Hec1 and reduces Nek2 protein levels in HeLa cells when used at a concentration of 25 µM. INH1 inhibits the growth of MDA-MB-468, SK-BR-3, T47D, MDA-MB-361,...
| Schlagworte: | IBT 13131, N-[4-(2,4-dimethylphenyl)-2-thiazolyl]-benzamide |
| Anwendung: | Hec1 /Nek2 interaction inhibitor |
| CAS | 313553-47-8 |
| MW: | 308.4 D |
ab 85,00 €
INH1
Artikelnummer: LKT-I530280.1
| Schlagworte: | Hec1/Nek2 Mitotic Pathway Inhibitor I, Benzamide,N-[4-(2,4-dimethylphenyl)-2-thiazolyl]-, IBT13131, AC1LIOIV,... |
| Anwendung: | Hec1/Nek2 interaction inhibitor, Apoptosis inducer |
| CAS | 313553-47-8 |
| MW: | 308.4 D |
ab 73,00 €
INH1
Artikelnummer: TGM-T2502-1mL
Description: INH1 (IBT13131) is a cell-permeable Hec1 inhibitor that specifically disrupts the Hec1/Nek2 interaction. Target: Microtubule Associated, MAPK, Apoptosis. Smiles: Cc1ccc(-c2csc(NC(=O)c3ccccc3)n2)c(C)c1
| Schlagworte: | IBT13131 |
| Anwendung: | Hec1 /Nek2 interaction inhibitor |
| CAS | 313553-47-8 |
| MW: | 308.4 D |
ab 29,00 €
