Zu "313-04-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
24-dehydro Cholesterol
Artikelnummer: Cay14943-1
24-dehydro Cholesterol is an immediate precursor to cholesterol in the Bloch pathway of cholesterol biosynthesis. Structurally, it varies from cholesterol only by a single double bond at carbon 24 and has been used as cholesterol substitute in cellular membrane studies. During brain development, 24-dehydro...
| Schlagworte: | Desmosterol, NSC 226126, (3beta)-cholesta-5,24-dien-3-ol |
| Anwendung: | Cholesterol precursor |
| CAS | 313-04-2 |
| MW: | 384.6 D |
ab 54,00 €
Desmosterol
Artikelnummer: TGM-T19711-1mg
Description: Desmosterol (24-Dehydrocholesterol) is a cholesterol biosynthesis intermediate that inhibits macrophage inflammatory vesicle activation and prevents vascular inflammation and atherosclerosis. Target: Endogenous Metabolite. Smiles: CC(CCC=C(C)C)C1CCC2C3CC=C4CC(O)CCC4(C)C3CCC12C. References: Clark RM, et...
| Schlagworte: | 24-Dehydrocholesterol, Desmesterol |
| Anwendung: | Cholesterol precursor |
| CAS | 313-04-2 |
| MW: | 384.64 D |
ab 29,00 €
