Zu "31137-74-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
SYM 2081
Artikelnummer: Cay41348-1
SYM 2081 is an agonist of the kainate receptor. It induces currents in Xenopus oocytes expressing homomeric GluK1 or GluK5 subunit-containing receptors (EC50s = 0.16 and 0.23 µM, respectively). It induces desensitization in HEK293 cells expressing homomeric GluK2 subunit-containing kainate receptors when used at...
| Schlagworte: | (2S,4R)-4-Methylglutamic Acid, L-erythro-4-methyl-Glutamic Acid, L-erythro-gamma-methyl-Glutamic Acid,... |
| Anwendung: | Kainate receptor agonist |
| CAS | 31137-74-3 |
| MW: | 161.2 D |
ab 35,00 €
SYM 2081
Artikelnummer: TGM-T16963-100mg
Description: SYM 2081 is a specific kainate receptor agonist with an IC50 value of 35 nM for [3H]-kainate binding. SYM 2081 depolarizes the muscle and reduces the EPSP amplitude. Target: iGluR. Smiles: [C@@H](C[C@@H](C(O)=O)N)(C(O)=O)C. References: Lee JY, et al. Furthering pharmacological and physiological...
| Anwendung: | Kainate receptor agonist |
| CAS | 31137-74-3 |
| MW: | 161.16 D |
ab 86,00 €
