Zu "30675-13-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
TCID
Artikelnummer: Cay16353-5
Ubiquitin carboxyl-terminal hydrolase isozyme L3 (UCH-L3) is a deubiquitinating enzyme and thiol-dependent hydrolase. TCID is a tetrachloro indandione that acts as a potent inhibitor of UCH-L3 and demonstrates 125-fold selectivity over UCH-L1 (IC50s = 0.6 and 75 µM, respectively).Formal Name:...
| Schlagworte: | UCH-L3 Inhibitor, 4,5,6,7-tetrachloro-1H-indene-1,3(2H)-dione |
| Anwendung: | Potent UCH-L3 inhibitor |
| CAS | 30675-13-9 |
| MW: | 283.9 D |
ab 110,00 €
TCID
Artikelnummer: TGM-T6697-100mg
Description: TCID (UCH-L3 Inhibitor)(IC50=0.6 µM) is a DUB inhibitor of ubiquitin C-terminal hydrolase L3. It has the 125-fold selectivity to L1. Target: DUB. Smiles: Clc1c2C(=O)CC(=O)c2c(Cl)c(Cl)c1Cl. References: Liu Y, et al. Chem Biol, 2003, 10(9), 837-846.
| Schlagworte: | UCH-L3 Inhibitor |
| Anwendung: | Potent UCH-L3 inhibitor |
| CAS | 30675-13-9 |
| MW: | 283.92 D |
ab 32,00 €
