Zu "306-08-1" wurden 4 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Homovanillic acid
Artikelnummer: TGM-T3S0507-500mg
Description: Homovanillic acid (Vanillacetic acid), a dopamine metabolite, is linked to aromatic L-amino acid decarboxylase deficiency, growth hormone deficiency, celiac disease, and sepiapterin reductase deficiency. Target: Endogenous Metabolite, Others. Smiles: COC1=C(O)C=CC(CC(O)=O)=C1. References: Molero-Luis M...
| Schlagworte: | Vanilacetic acid, Vanillacetic acid, Homovaniuic acid |
| CAS | 306-08-1 |
| MW: | 182.17 D |
57,00 €
Homovanillic Acid
Artikelnummer: Cay27307-250
Homovanillic acid (HVA) is a dopamine metabolite. It is formed via deamination of dopamine by monoamine oxidase (MAO) to produce 3,4-dihydroxyphenylacetic acid (DOPAC, Cay-24912) followed by DOPAC metabolism by catechol-O-methyltransferase (COMT). HVA undergoes hydrogen peroxide-dependent oxidation in the presence...
| Schlagworte: | HVA, NSC 16682, Vanilacetic Acid, 4-hydroxy-3-methoxy-benzeneacetic acid |
| Anwendung: | Dopamine metabolite, hydrogen peroxide production quantification |
| CAS | 306-08-1 |
| MW: | 182.2 D |
ab 44,00 €
![4-Hydroxy-3-Methoxyphenyl-[D3]-acetic-[D2] Acid](/custom/plugins/NetiThemeBiomol/Resources/Themes/Frontend/Biomol/frontend/_public/src/img/no-picture.jpg "4-Hydroxy-3-Methoxyphenyl-[D3]-acetic-[D2] Acid")
4-Hydroxy-3-Methoxyphenyl-[D3]-acetic-[D2] Acid
Artikelnummer: ISO-S10413-0.1
Isotope Incorporation: >98%
| Schlagworte: | Deuterium-labelled, HVA-[2H5] |
| Anwendung: | LC/MS internal standard |
| CAS | 306-08-1 |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
Homovanillic Acid (HVA)
Artikelnummer: ISO-S10413UNL-1.0
| Schlagworte: | unlabelled |
| CAS | 306-08-1 |
| MW: | 182 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
