Zu "30544-47-9" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Etofenamate
Artikelnummer: Cay23674-250
Etofenamate is a non-steroidal anti-inflammatory drug (NSAID) and diethylene glycol ester form of flufenamic acid (Cay-21447) that has anti-inflammatory and analgesic activities. It inhibits lipoxygenase isolated from guinea pig leukocytes (IC50 = 5.3 µM) and the production of prostaglandin E2 (PGE2, Cay-14010) in...
| Schlagworte: | 2-[[3-(trifluoromethyl)phenyl]amino]-benzoic acid, 2-(2-hydroxyethoxy)ethyl ester |
| Anwendung: | COX inhibitor |
| CAS | 30544-47-9 |
| MW: | 369.3 D |
ab 137,00 €
Etofenamate
Artikelnummer: LKT-E7857.10
NSAID, COX-1/2 and lipoxygenase inhibitor.
| Anwendung: | Cyclooxygenase-1 (COX-1) inhibitor, cyclooxygenase-2 (COX-2) inhibitor |
| CAS | 30544-47-9 |
| MW: | 369.34 D |
ab 136,00 €
Etofenamate
Artikelnummer: TGM-T2553-1mL
Description: Etofenamate is a non-steroidal anti-inflammatory drug (NSAID) used for the treatment of joint and muscular pain. Target: COX. Smiles: N(C1=C(C(OCCOCCO)=O)C=CC=C1)C2=CC(C(F)(F)F)=CC=C2. References: Bender T, et al. Arzneimittelforschung. 2001,51(6):489-92.
| Anwendung: | Targets prostaglandin-endoperoxide synthase 1 [EC:1.14.99.1] (PTGS1, COX1) |
| CAS | 30544-47-9 |
| MW: | 369.33 D |
ab 35,00 €
