Zu "304896-28-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
AGK2
Artikelnummer: TGM-T6371-100mg
Description: AGK2(IC50=3.5 µM) is an effective, and specific SIRT2 inhibitor. Target: Apoptosis, Sirtuin. Smiles: Clc1ccc(Cl)c(c1)-c1ccc(C=C(C#N)C(=O)Nc2cccc3ncccc23)o1. References: Outeiro TF, et al. Science.2007, 317(5837), 516-519.
| Anwendung: | SIRT2 inhibitor |
| CAS | 304896-28-4 |
| MW: | 434.27 D |
ab 31,00 €
AGK2
Artikelnummer: Cay13145-5
Mammalian sirtuin 2 (SIRT2) is a nicotinamide adenine dinucleotide-dependent histone deacetylase (HDAC) with roles in cell cycle progression and tumorigenesis. AGK2 is a cell-permeable, selective inhibitor of SIRT2 (IC50 = 3.5 µM) that minimally affects either SIRT1 or SIRT3 at 10-fold higher levels. It rescues...
| Schlagworte: | 2-cyano-3-[5-(2,5-dichlorophenyl)-2-furanyl]-N-5-quinolinyl-2-propenamide |
| Anwendung: | SIRT2 inhibitor |
| CAS | 304896-28-4 |
| MW: | 434.3 D |
ab 44,00 €
