Zu "304-55-2" wurden 4 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Meso-2,3-dimercaptosuccinic Acid
Artikelnummer: LKT-D4873.1
Organosulfur, chelating agent.
| Schlagworte: | Succimer, DMS, DMSA, (2R, 3S)-rel-2,3-Dimer-captobutanedioic acid |
| Anwendung: | Chelating agent |
| CAS | 304-55-2 |
| MW: | 182.22 D |
ab 71,00 €
meso-2,3-Dimercaptosuccinic Acid
Artikelnummer: Cay28515-1
meso-2,3-Dimercaptosuccinic acid is a heavy metal chelator. It reverses sodium arsenite-induced inhibition of pyruvate dehydrogenase (PDH) in mouse kidney homogenates (EC50 = 0.25 mM). meso-2,3-Dimercaptosuccinic acid decreases cisplatin-induced increases in serum levels of platinum and blood urea nitrogen (BUN), as...
| Schlagworte: | DMSA, Succimer, (2R,3S)-rel-2,3-dimercapto-butanedioic acid |
| Anwendung: | Heavy metal chelator |
| CAS | 304-55-2 |
| MW: | 182.2 D |
ab 51,00 €
Succimer
Artikelnummer: TGM-T2552-500mg
Description: Succimer (Dimercaptosuccinic acid) is a Lead Chelator. The mechanism of action of succimer is as a Lead Chelating Activity. Target: Others. Smiles: [C@H]([C@H](C(O)=O)S)(C(O)=O)S. References: Blanusa M, et al. Curr Med Chem. 2005,12(23):2771-94.
| Schlagworte: | meso-2,3-dimercaptosuccinic acid, Dimercaptosuccinic acid, DMSA |
| Anwendung: | Antidote (lead), Diagnostic aid |
| CAS | 304-55-2 |
| MW: | 182.22 D |
ab 39,00 €
