Zu "302841-86-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Ro 01-6128
Artikelnummer: Cay11991-5
Glutamate, the major excitatory neurotransmitter in the CNS, activates eight known subtypes of metabotropic glutamate receptors (mGluRs). Highly selective modulators designed to act at allosteric sites on certain mGluR subtypes are being developed to preferentially regulate subtype-specific, glutamate-induced...
| Schlagworte: | N-(2,2-diphenylacetyl)-carbamic acid, ethyl ester |
| Anwendung: | mGluR1 modulator |
| CAS | 302841-86-7 |
| MW: | 283.3 D |
ab 38,00 €
Ro 01-6128
Artikelnummer: TGM-T23238-2mg
Description: Positive allosteric modulator of mGlu1 receptors. Target: Others. Smiles: C(C(NC(OCC)=O)=O)(C1=CC=CC=C1)C2=CC=CC=C2
| Anwendung: | mGluR1 modulator |
| CAS | 302841-86-7 |
| MW: | 283.32 D |
57,00 €
