Zu "3026502-95-1" wurden 1 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
WRN Inhibitor 8
Artikelnummer: Cay43724-1
WRN inhibitor 8 is an inhibitor of the DNA helicase Werner syndrome protein (WRN, IC50 = 48.3 nM). It inhibits the growth of HCT116 and SW480 colorectal cancer cells (GI50s = 0.01699 and 13.64 µM, respectively). SMILES FC(F)(C1CC1)C2=NC=C(C(OC3=CC=CC=C3)=N2)C(N[C@H](/C=C/S(=O)(C)=O)C4CC4)=O InChi Code...
| Schlagworte: | 2-(cyclopropyldifluoromethyl)-N-[(1S,2E)-1-cyclopropyl-3-(methylsulfonyl)-2-propen-1-yl]-4-phenoxy-5-pyrimidinecarboxamide |
| Anwendung: | WRN inhibitor |
| CAS | 3026502-95-1 |
| MW: | 463.5 D |
ab 216,00 €
